C12H23F3N4O2S — CID 109472157
2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472157) has the molecular formula C12H23F3N4O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472157 |
| Molecular Formula | C12H23F3N4O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-methyl-1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H23F3N4O2S/c1-16-11(17-6-5-12(13,14)15)18-9-10-3-7-19(8-4-10)22(2,20)21/h10H,3-9H2,1-2H3,(H2,16,17,18) |
| InChIKey | QGIHUGSODUOQES-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|