C13H25F3N4O2S — CID 109472159
1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472159) has the molecular formula C13H25F3N4O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472159 |
| Molecular Formula | C13H25F3N4O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N4O2S/c1-3-17-12(18-7-6-13(14,15)16)19-10-11-4-8-20(9-5-11)23(2,21)22/h11H,3-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | CXDFSUUZIOSZAR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|