C20H32F3IN4 — CID 109473464
2-[[3-(azepan-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473464) has the molecular formula C20H32F3IN4 and a molecular weight of 512.40 g/mol. Its IUPAC name is 2-[[3-(azepan-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(azepan-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473464 |
| Molecular Formula | C20H32F3IN4 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-[[3-(azepan-1-ylmethyl)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCCCC2)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C20H31F3N4.HI/c1-2-24-19(25-11-10-20(21,22)23)26-15-17-8-7-9-18(14-17)16-27-12-5-3-4-6-13-27;/h7-9,14H,2-6,10-13,15-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | SBOXUCMKVGWJRL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|