C15H29F3N4O2 — CID 109474477
tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 109474477) has the molecular formula C15H29F3N4O2 and a molecular weight of 354.42 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 109474477 |
| Molecular Formula | C15H29F3N4O2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCN(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29F3N4O2/c1-6-19-12(20-9-8-15(16,17)18)21-10-11-22(7-2)13(23)24-14(3,4)5/h6-11H2,1-5H3,(H2,19,20,21) |
| InChIKey | KPDSULXXRXZRSB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|