C12H24F3IN4 — CID 109474932
1-[(1-ethylpyrrolidin-3-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474932) has the molecular formula C12H24F3IN4 and a molecular weight of 408.25 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-3-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474932 |
| Molecular Formula | C12H24F3IN4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN1CCC(CN/C(=N/C)NCCC(F)(F)F)C1.I |
| InChI | InChI=1S/C12H23F3N4.HI/c1-3-19-7-4-10(9-19)8-18-11(16-2)17-6-5-12(13,14)15;/h10H,3-9H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | VYZRBAQEIDMGBM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|