C15H22BrF3IN3OS — CID 109475048
1-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109475048) has the molecular formula C15H22BrF3IN3OS and a molecular weight of 556.23 g/mol. Its IUPAC name is 1-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109475048 |
| Molecular Formula | C15H22BrF3IN3OS |
| Molecular Weight | 556.23 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | 1-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCSCCOc1cccc(Br)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H21BrF3N3OS.HI/c1-20-14(21-6-5-15(17,18)19)22-7-9-24-10-8-23-13-4-2-3-12(16)11-13;/h2-4,11H,5-10H2,1H3,(H2,20,21,22);1H |
| InChIKey | UZFOINZFNLDTLX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|