C21H32FIN4O2 — CID 109476240
2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-ethyl-3-[2-(3-fluorophenoxy)butyl]guanidine;hydroiodide (PubChem CID 109476240) has the molecular formula C21H32FIN4O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-ethyl-3-[2-(3-fluorophenoxy)butyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-ethyl-3-[2-(3-fluorophenoxy)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109476240 |
| Molecular Formula | C21H32FIN4O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-ethyl-3-[2-(3-fluorophenoxy)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1c(C)noc1C)NCC(CC)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C21H31FN4O2.HI/c1-6-18(27-19-10-8-9-17(22)11-19)13-25-21(23-7-2)24-12-14(3)20-15(4)26-28-16(20)5;/h8-11,14,18H,6-7,12-13H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | RQKHMWBUEFTTRK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|