C20H31F4IN4O — CID 109476300
1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 109476300) has the molecular formula C20H31F4IN4O and a molecular weight of 546.39 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109476300 |
| Molecular Formula | C20H31F4IN4O |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)Oc1cccc(F)c1)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C20H30F4N4O.HI/c1-3-17(29-18-7-5-6-16(21)10-18)12-27-19(25-4-2)26-11-15-8-9-28(13-15)14-20(22,23)24;/h5-7,10,15,17H,3-4,8-9,11-14H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | KGCLHFYMMUAVQI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|