C18H23F7N4 — CID 111890007
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111890007) has the molecular formula C18H23F7N4 and a molecular weight of 428.40 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111890007 |
| Molecular Formula | C18H23F7N4 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H23F7N4/c1-2-26-16(27-8-12-5-6-29(10-12)11-17(20,21)22)28-9-13-3-4-14(19)7-15(13)18(23,24)25/h3-4,7,12H,2,5-6,8-11H2,1H3,(H2,26,27,28) |
| InChIKey | IAMQXTVBNUFOCU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|