C19H30F3IN4 — CID 111938716
2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111938716) has the molecular formula C19H30F3IN4 and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111938716 |
| Molecular Formula | C19H30F3IN4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C19H29F3N4.HI/c1-4-23-18(25-11-17-6-5-14(2)9-15(17)3)24-10-16-7-8-26(12-16)13-19(20,21)22;/h5-6,9,16H,4,7-8,10-13H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | ZXAWHSCDNQHBDE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|