C17H30F3IN6 — CID 111953176
1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111953176) has the molecular formula C17H30F3IN6 and a molecular weight of 502.37 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111953176 |
| Molecular Formula | C17H30F3IN6 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C17H29F3N6.HI/c1-5-21-16(23-9-15-12(2)24-25(4)13(15)3)22-8-14-6-7-26(10-14)11-17(18,19)20;/h14H,5-11H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | PLESILOCGRXBIY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|