C22H36F3IN4O — CID 109493352
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 109493352) has the molecular formula C22H36F3IN4O and a molecular weight of 556.46 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493352 |
| Molecular Formula | C22H36F3IN4O |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C22H35F3N4O.HI/c1-5-26-20(27-12-16-10-11-29(14-16)15-22(23,24)25)28-13-19(30)17-6-8-18(9-7-17)21(2,3)4;/h6-9,16,19,30H,5,10-15H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | RWFXVQIRBBETAW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|