C17H24O5Si — CID 10947689
dimethyl 5-oxo-6-trimethylsilylspiro[3,3a-dihydro-1H-pentalene-4,1'-cyclopropane]-2,2-dicarboxylate (PubChem CID 10947689) has the molecular formula C17H24O5Si and a molecular weight of 336.46 g/mol. Its IUPAC name is dimethyl 5-oxo-6-trimethylsilylspiro[3,3a-dihydro-1H-pentalene-4,1'-cyclopropane]-2,2-dicarboxylate.
| Compound Name | dimethyl 5-oxo-6-trimethylsilylspiro[3,3a-dihydro-1H-pentalene-4,1'-cyclopropane]-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10947689 |
| Molecular Formula | C17H24O5Si |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | dimethyl 5-oxo-6-trimethylsilylspiro[3,3a-dihydro-1H-pentalene-4,1'-cyclopropane]-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C([Si](C)(C)C)C(=O)C3(CC3)C2C1 |
| InChI | InChI=1S/C17H24O5Si/c1-21-14(19)17(15(20)22-2)8-10-11(9-17)16(6-7-16)13(18)12(10)23(3,4)5/h11H,6-9H2,1-5H3 |
| InChIKey | FBBCFRWMGPXTGS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|