C18H25F2NO3 — CID 109479423
2,2-difluoro-N-[3-(2-hydroxycyclohexyl)propyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 109479423) has the molecular formula C18H25F2NO3 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-(2-hydroxycyclohexyl)propyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2,2-difluoro-N-[3-(2-hydroxycyclohexyl)propyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 109479423 |
| Molecular Formula | C18H25F2NO3 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2,2-difluoro-N-[3-(2-hydroxycyclohexyl)propyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(F)(F)C(=O)NCCCC2CCCCC2O)cc1 |
| InChI | InChI=1S/C18H25F2NO3/c1-24-15-10-8-14(9-11-15)18(19,20)17(23)21-12-4-6-13-5-2-3-7-16(13)22/h8-11,13,16,22H,2-7,12H2,1H3,(H,21,23) |
| InChIKey | NIGFCYGAOHHCNC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|