C14H19F2NO3 — CID 109478693
2,2-difluoro-N-(3-hydroxypentyl)-2-(4-methoxyphenyl)acetamide (PubChem CID 109478693) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2,2-difluoro-N-(3-hydroxypentyl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2,2-difluoro-N-(3-hydroxypentyl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 109478693 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2,2-difluoro-N-(3-hydroxypentyl)-2-(4-methoxyphenyl)acetamide |
| SMILES | CCC(O)CCNC(=O)C(F)(F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19F2NO3/c1-3-11(18)8-9-17-13(19)14(15,16)10-4-6-12(20-2)7-5-10/h4-7,11,18H,3,8-9H2,1-2H3,(H,17,19) |
| InChIKey | LCAKZYLSJLDFRF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |