C19H28N4O — CID 109479915
[1-[4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 109479915) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is [1-[4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 109479915 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | [1-[4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | Cc1nn(C)cc1CNCc1ccc(N2CCC(CO)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O/c1-15-18(13-22(2)21-15)12-20-11-16-3-5-19(6-4-16)23-9-7-17(14-24)8-10-23/h3-6,13,17,20,24H,7-12,14H2,1-2H3 |
| InChIKey | SBUFEMPZLICUIQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|