C22H25NO3 — CID 10948129
N-benzyl-N-[[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]benzamide (PubChem CID 10948129) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-benzyl-N-[[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]benzamide.
| Compound Name | N-benzyl-N-[[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10948129 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-benzyl-N-[[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]benzamide |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1CN(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-4-19-20(26-22(2,3)25-19)16-23(15-17-11-7-5-8-12-17)21(24)18-13-9-6-10-14-18/h4-14,19-20H,1,15-16H2,2-3H3/t19-,20+/m0/s1 |
| InChIKey | JDDJMCOCDQLGSX-VQTJNVASSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|