C18H36N4O — CID 109482971
N-[2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 109482971) has the molecular formula C18H36N4O and a molecular weight of 324.51 g/mol. Its IUPAC name is N-[2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109482971 |
| Molecular Formula | C18H36N4O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | N-[2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | C=CCCCCCN(C)/C(=N/CCNC(=O)C(C)(C)C)NCC |
| InChI | InChI=1S/C18H36N4O/c1-7-9-10-11-12-15-22(6)17(19-8-2)21-14-13-20-16(23)18(3,4)5/h7H,1,8-15H2,2-6H3,(H,19,21)(H,20,23) |
| InChIKey | OIXMKCDFXKEAJU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|