C15H30IN3 — CID 109483718
2-ethyl-1-hept-6-enyl-1-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 109483718) has the molecular formula C15H30IN3 and a molecular weight of 379.33 g/mol. Its IUPAC name is 2-ethyl-1-hept-6-enyl-1-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-hept-6-enyl-1-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483718 |
| Molecular Formula | C15H30IN3 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-ethyl-1-hept-6-enyl-1-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\CC)NC1CC1C.I |
| InChI | InChI=1S/C15H29N3.HI/c1-5-7-8-9-10-11-18(4)15(16-6-2)17-14-12-13(14)3;/h5,13-14H,1,6-12H2,2-4H3,(H,16,17);1H |
| InChIKey | DSOWPIYUYGPOCN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|