C21H41IN4O — CID 109484567
3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109484567) has the molecular formula C21H41IN4O and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109484567 |
| Molecular Formula | C21H41IN4O |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CC1(N2CCCC2)CCOCC1)NCC.I |
| InChI | InChI=1S/C21H40N4O.HI/c1-4-6-7-8-9-14-24(3)20(22-5-2)23-19-21(12-17-26-18-13-21)25-15-10-11-16-25;/h4H,1,5-19H2,2-3H3,(H,22,23);1H |
| InChIKey | BACBHUWBAAZVFW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|