C16H32IN3O — CID 109498855
3-ethyl-2-[(1-hydroxycyclohexyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498855) has the molecular formula C16H32IN3O and a molecular weight of 409.36 g/mol. Its IUPAC name is 3-ethyl-2-[(1-hydroxycyclohexyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[(1-hydroxycyclohexyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498855 |
| Molecular Formula | C16H32IN3O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-ethyl-2-[(1-hydroxycyclohexyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CC1(O)CCCCC1)NCC.I |
| InChI | InChI=1S/C16H31N3O.HI/c1-4-6-10-13-19(3)15(17-5-2)18-14-16(20)11-8-7-9-12-16;/h4,20H,1,5-14H2,2-3H3,(H,17,18);1H |
| InChIKey | WWDZUJMVDVQFDW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|