C21H33FIN3O — CID 109497452
3-ethyl-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497452) has the molecular formula C21H33FIN3O and a molecular weight of 489.42 g/mol. Its IUPAC name is 3-ethyl-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497452 |
| Molecular Formula | C21H33FIN3O |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-ethyl-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CC1(c2ccc(F)cc2)CCOCC1)NCC.I |
| InChI | InChI=1S/C21H32FN3O.HI/c1-4-6-7-14-25(3)20(23-5-2)24-17-21(12-15-26-16-13-21)18-8-10-19(22)11-9-18;/h4,8-11H,1,5-7,12-17H2,2-3H3,(H,23,24);1H |
| InChIKey | YFWWDUQNTHBWMS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|