C20H28NO4P — CID 10948834
(1R)-N-[(R)-diethoxyphosphoryl(phenyl)methyl]-2-methoxy-1-phenylethanamine (PubChem CID 10948834) has the molecular formula C20H28NO4P and a molecular weight of 377.42 g/mol. Its IUPAC name is (1R)-N-[(R)-diethoxyphosphoryl(phenyl)methyl]-2-methoxy-1-phenylethanamine.
| Compound Name | (1R)-N-[(R)-diethoxyphosphoryl(phenyl)methyl]-2-methoxy-1-phenylethanamine |
|---|---|
| PubChem CID | 10948834 |
| Molecular Formula | C20H28NO4P |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (1R)-N-[(R)-diethoxyphosphoryl(phenyl)methyl]-2-methoxy-1-phenylethanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N[C@@H](COC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28NO4P/c1-4-24-26(22,25-5-2)20(18-14-10-7-11-15-18)21-19(16-23-3)17-12-8-6-9-13-17/h6-15,19-21H,4-5,16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | HHRPKWJJOARFNN-VQTJNVASSA-N |
| XLogP | 4.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|