C15H27N5OS — CID 109489443
N',2,2-trimethyl-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109489443) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489443 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N',2,2-trimethyl-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCc1nc(C(C)C)no1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C15H27N5OS/c1-11(2)13-18-12(21-19-13)6-7-17-14(16-5)20-8-9-22-15(3,4)10-20/h11H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | PPWIZOGAZMRHQX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|