C14H27F2N3 — CID 109490464
N'-(2,2-difluoroethyl)-N-ethyl-3-methyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490464) has the molecular formula C14H27F2N3 and a molecular weight of 275.39 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N-ethyl-3-methyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N'-(2,2-difluoroethyl)-N-ethyl-3-methyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490464 |
| Molecular Formula | C14H27F2N3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N-ethyl-3-methyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/CC(F)F)NCC)C1 |
| InChI | InChI=1S/C14H27F2N3/c1-4-7-14(3)8-6-9-19(11-14)13(17-5-2)18-10-12(15)16/h12H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | FSVGMXVUNCRHIN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|