C13H25F2N3 — CID 109490574
N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490574) has the molecular formula C13H25F2N3 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490574 |
| Molecular Formula | C13H25F2N3 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCC(F)F)C1 |
| InChI | InChI=1S/C13H25F2N3/c1-4-6-13(2)7-5-8-18(10-13)12(16-3)17-9-11(14)15/h11H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | RQGUWESULHVJDH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|