C20H32IN5O2 — CID 109491191
1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 109491191) has the molecular formula C20H32IN5O2 and a molecular weight of 501.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109491191 |
| Molecular Formula | C20H32IN5O2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC(C)C)c1)NCCn1cc(C)cn1.I |
| InChI | InChI=1S/C20H31N5O2.HI/c1-5-21-20(22-9-10-25-14-16(4)12-24-25)23-13-19(26)17-7-6-8-18(11-17)27-15(2)3;/h6-8,11-12,14-15,19,26H,5,9-10,13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | HKAVODPZFQXLDP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|