C22H30O6 — CID 10949173
diethyl 2-[(1R,2R)-2-[(1R)-1-hydroxy-3-phenylpropyl]-3-oxocyclopentyl]-2-methylpropanedioate (PubChem CID 10949173) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-[(1R)-1-hydroxy-3-phenylpropyl]-3-oxocyclopentyl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(1R,2R)-2-[(1R)-1-hydroxy-3-phenylpropyl]-3-oxocyclopentyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 10949173 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-[(1R)-1-hydroxy-3-phenylpropyl]-3-oxocyclopentyl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)[C@@H]1CCC(=O)[C@H]1[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C22H30O6/c1-4-27-20(25)22(3,21(26)28-5-2)16-12-14-18(24)19(16)17(23)13-11-15-9-7-6-8-10-15/h6-10,16-17,19,23H,4-5,11-14H2,1-3H3/t16-,17-,19-/m1/s1 |
| InChIKey | OLKSNLBWHVJHKQ-ZHALLVOQSA-N |
| XLogP | 2.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|