C21H20N4O4 — CID 10949216
tert-butyl (7R,11S)-9-methyl-8,10-dioxo-4,6,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2,4,13,15,17-hexaene-19-carboxylate (PubChem CID 10949216) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is tert-butyl (7R,11S)-9-methyl-8,10-dioxo-4,6,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2,4,13,15,17-hexaene-19-carboxylate.
| Compound Name | tert-butyl (7R,11S)-9-methyl-8,10-dioxo-4,6,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2,4,13,15,17-hexaene-19-carboxylate |
|---|---|
| PubChem CID | 10949216 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | tert-butyl (7R,11S)-9-methyl-8,10-dioxo-4,6,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2,4,13,15,17-hexaene-19-carboxylate |
| SMILES | CN1C(=O)[C@H]2c3c(n(C(=O)OC(C)(C)C)c4ccccc34)-c3cncn3[C@H]2C1=O |
| InChI | InChI=1S/C21H20N4O4/c1-21(2,3)29-20(28)25-12-8-6-5-7-11(12)14-15-17(19(27)23(4)18(15)26)24-10-22-9-13(24)16(14)25/h5-10,15,17H,1-4H3/t15-,17+/m0/s1 |
| InChIKey | UBLWHEBNMBEJGR-DOTOQJQBSA-N |
| XLogP | 2.92 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|