C19H25F3N4O2S — CID 109494451
1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 109494451) has the molecular formula C19H25F3N4O2S and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109494451 |
| Molecular Formula | C19H25F3N4O2S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCC(O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C19H25F3N4O2S/c1-4-23-18(25-10-17-26-16(11-29-17)19(20,21)22)24-9-15(27)13-5-7-14(8-6-13)28-12(2)3/h5-8,11-12,15,27H,4,9-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | PXNBUBUWDWZRDS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|