C18H23F4N5S — CID 111615587
1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615587) has the molecular formula C18H23F4N5S and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615587 |
| Molecular Formula | C18H23F4N5S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCC(c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C18H23F4N5S/c1-4-23-17(25-10-16-26-15(11-28-16)18(20,21)22)24-9-14(27(2)3)12-5-7-13(19)8-6-12/h5-8,11,14H,4,9-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | GWJIAGIGKDYZMS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|