C19H32N4S — CID 109496278
1,2-dimethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1-pent-4-enylguanidine (PubChem CID 109496278) has the molecular formula C19H32N4S and a molecular weight of 348.56 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496278 |
| Molecular Formula | C19H32N4S |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C19H32N4S/c1-5-6-7-12-23(4)19(20-2)21-15-16-10-8-13-22(3)18(16)17-11-9-14-24-17/h5,9,11,14,16,18H,1,6-8,10,12-13,15H2,2-4H3,(H,20,21) |
| InChIKey | DAKVRQAZSZZPFC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|