C18H35N5O — CID 109496608
1-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 109496608) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 109496608 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 1-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | C=CCCCN(C)/C(=N\C)NCCCN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C18H35N5O/c1-6-7-8-13-22(5)18(19-2)20-12-10-15-23-14-9-11-16(23)17(24)21(3)4/h6,16H,1,7-15H2,2-5H3,(H,19,20) |
| InChIKey | WLFMBHDUTVXUKH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|