C17H33IN4OS — CID 109497943
1,2-dimethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497943) has the molecular formula C17H33IN4OS and a molecular weight of 468.45 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497943 |
| Molecular Formula | C17H33IN4OS |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1,2-dimethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC1(N2CCOCC2)CCSC1.I |
| InChI | InChI=1S/C17H32N4OS.HI/c1-4-5-6-8-20(3)16(18-2)19-14-17(7-13-23-15-17)21-9-11-22-12-10-21;/h4H,1,5-15H2,2-3H3,(H,18,19);1H |
| InChIKey | YVNDCILABRYATL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|