C17H33N3O3S — CID 109483985
1-hept-6-enyl-1,2-dimethyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine (PubChem CID 109483985) has the molecular formula C17H33N3O3S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109483985 |
| Molecular Formula | C17H33N3O3S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1(S(C)(=O)=O)CCOCC1 |
| InChI | InChI=1S/C17H33N3O3S/c1-5-6-7-8-9-12-20(3)16(18-2)19-15-17(24(4,21)22)10-13-23-14-11-17/h5H,1,6-15H2,2-4H3,(H,18,19) |
| InChIKey | LPNFXYWHPULRFV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|