C30H44O3S2Si — CID 10951695
10-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-hydroxydecan-3-one (PubChem CID 10951695) has the molecular formula C30H44O3S2Si and a molecular weight of 544.90 g/mol. Its IUPAC name is 10-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-hydroxydecan-3-one.
| Compound Name | 10-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-hydroxydecan-3-one |
|---|---|
| PubChem CID | 10951695 |
| Molecular Formula | C30H44O3S2Si |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 10-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-hydroxydecan-3-one |
| SMILES | CC(C)(C)[Si](OCCCCCCC(O)C(=O)CCC1SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H44O3S2Si/c1-30(2,3)36(25-15-8-6-9-16-25,26-17-10-7-11-18-26)33-22-13-5-4-12-19-27(31)28(32)20-21-29-34-23-14-24-35-29/h6-11,15-18,27,29,31H,4-5,12-14,19-24H2,1-3H3 |
| InChIKey | IEKKBLRLPMJKSI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|