C17H21O7P — CID 10951749
2-diethoxyphosphoryl-3-(2,5-dihydroxynaphthalen-1-yl)propanoic acid (PubChem CID 10951749) has the molecular formula C17H21O7P and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-(2,5-dihydroxynaphthalen-1-yl)propanoic acid.
| Compound Name | 2-diethoxyphosphoryl-3-(2,5-dihydroxynaphthalen-1-yl)propanoic acid |
|---|---|
| PubChem CID | 10951749 |
| Molecular Formula | C17H21O7P |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-diethoxyphosphoryl-3-(2,5-dihydroxynaphthalen-1-yl)propanoic acid |
| SMILES | CCOP(=O)(OCC)C(Cc1c(O)ccc2c(O)cccc12)C(=O)O |
| InChI | InChI=1S/C17H21O7P/c1-3-23-25(22,24-4-2)16(17(20)21)10-13-11-6-5-7-14(18)12(11)8-9-15(13)19/h5-9,16,18-19H,3-4,10H2,1-2H3,(H,20,21) |
| InChIKey | XRGVYWNDCJJSTM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|