About dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine
dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine (PubChem CID 10952302) has the molecular formula C30H22Br2N2Ni
and a molecular weight of 629.02 g/mol. Its IUPAC name is dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine.
Molecular Properties
| Compound Name | dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine |
| PubChem CID | 10952302 |
| Molecular Formula | C30H22Br2N2Ni |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 625.95 |
| IUPAC Name | dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine |
| SMILES | Br[Ni]Br.C(=N/c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)\c1ccccn1 |
| InChI | InChI=1S/C30H22N2.2BrH.Ni/c1-4-12-23(13-5-1)26-20-28(24-14-6-2-7-15-24)30(32-22-27-18-10-11-19-31-27)29(21-26)25-16-8-3-9-17-25;;;/h1-22H;2*1H;/q;;;+2/p-2/b32-22+;;; |
| InChIKey | RJQKKWVKJMSTHW-KFIQQVOFSA-L |
| XLogP | 9.52 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine?
The IUPAC name of dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine (CID 10952302) is dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine.
What is the SMILES notation for dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine?
The canonical SMILES for dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine is Br[Ni]Br.C(=N/c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)\c1ccccn1.
What is the InChIKey of dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine?
The InChIKey is RJQKKWVKJMSTHW-KFIQQVOFSA-L. The full InChI is InChI=1S/C30H22N2.2BrH.Ni/c1-4-12-23(13-5-1)26-20-28(24-14-6-2-7-15-24)30(32-22-27-18-10-11-19-31-27)29(21-26)25-16-8-3-9-17-25;;;/h1-22H;2*1H;/q;;;+2/p-2/b32-22+;;;.
What are the key properties of dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine?
dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine has a molecular weight of 629.02 g/mol, XLogP of 9.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibromonickel;1-pyridin-2-yl-N-(2,4,6-triphenylphenyl)methanimine is sourced from PubChem (CID 10952302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).