C36H49NO8Si — CID 10952417
tert-butyl (2S)-3-[[(4aR,6S,8aR)-2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]oxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 10952417) has the molecular formula C36H49NO8Si and a molecular weight of 651.87 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[(4aR,6S,8aR)-2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]oxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[[(4aR,6S,8aR)-2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]oxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10952417 |
| Molecular Formula | C36H49NO8Si |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.32 |
| IUPAC Name | tert-butyl (2S)-3-[[(4aR,6S,8aR)-2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]oxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CO[C@@H]1C=C[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H49NO8Si/c1-34(2,3)44-32(38)28(37-33(39)41-20-27-25-16-12-10-14-23(25)24-15-11-13-17-26(24)27)21-40-31-19-18-29-30(43-31)22-42-46(45-29,35(4,5)6)36(7,8)9/h10-19,27-31H,20-22H2,1-9H3,(H,37,39)/t28-,29+,30+,31-/m0/s1 |
| InChIKey | ZJSMEFKPJFJRRL-KQFVITFDSA-N |
| XLogP | 6.99 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|