C53H48IrP3S- — CID 10953173
[3-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-methylpropyl]-diphenylphosphane;iridium;2-phenylbenzenethiolate (PubChem CID 10953173) has the molecular formula C53H48IrP3S- and a molecular weight of 1002.17 g/mol. Its IUPAC name is [3-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-methylpropyl]-diphenylphosphane;iridium;2-phenylbenzenethiolate.
| Compound Name | [3-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-methylpropyl]-diphenylphosphane;iridium;2-phenylbenzenethiolate |
|---|---|
| PubChem CID | 10953173 |
| Molecular Formula | C53H48IrP3S- |
| Molecular Weight | 1002.17 g/mol |
| Exact Mass | 1002.23 |
| IUPAC Name | [3-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-methylpropyl]-diphenylphosphane;iridium;2-phenylbenzenethiolate |
| SMILES | CC(CP(c1ccccc1)c1ccccc1)(CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.[Ir].[S-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C41H39P3.C12H10S.Ir/c1-41(32-42(35-20-8-2-9-21-35)36-22-10-3-11-23-36,33-43(37-24-12-4-13-25-37)38-26-14-5-15-27-38)34-44(39-28-16-6-17-29-39)40-30-18-7-19-31-40;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h2-31H,32-34H2,1H3;1-9,13H;/p-1 |
| InChIKey | JFPXRQCHOBLNJE-UHFFFAOYSA-M |
| XLogP | 11.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.17 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|