C9H9NO2 — CID 10953852
8-hydroxy-4a,8a-dihydro-1H-quinolin-2-one (PubChem CID 10953852) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 8-hydroxy-4a,8a-dihydro-1H-quinolin-2-one.
| Compound Name | 8-hydroxy-4a,8a-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10953852 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 8-hydroxy-4a,8a-dihydro-1H-quinolin-2-one |
| SMILES | O=C1C=CC2C=CC=C(O)C2N1 |
| InChI | InChI=1S/C9H9NO2/c11-7-3-1-2-6-4-5-8(12)10-9(6)7/h1-6,9,11H,(H,10,12) |
| InChIKey | GIHZRRLFJSDREW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |