C11H12NO2+ — CID 143863591
(6-ethenyl-2-oxo-4a,8a-dihydro-1H-quinolin-4-yl)oxidanium (PubChem CID 143863591) has the molecular formula C11H12NO2+ and a molecular weight of 190.22 g/mol. Its IUPAC name is (6-ethenyl-2-oxo-4a,8a-dihydro-1H-quinolin-4-yl)oxidanium.
| Compound Name | (6-ethenyl-2-oxo-4a,8a-dihydro-1H-quinolin-4-yl)oxidanium |
|---|---|
| PubChem CID | 143863591 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (6-ethenyl-2-oxo-4a,8a-dihydro-1H-quinolin-4-yl)oxidanium |
| SMILES | C=CC1=CC2C([OH2+])=CC(=O)NC2C=C1 |
| InChI | InChI=1S/C11H11NO2/c1-2-7-3-4-9-8(5-7)10(13)6-11(14)12-9/h2-6,8-9,13H,1H2,(H,12,14)/p+1 |
| InChIKey | NZLUMHPLPKJVPO-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|