C7H11NO2 — CID 131146974
(2R)-3-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-5-one (PubChem CID 131146974) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-5-one.
| Compound Name | (2R)-3-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 131146974 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (2R)-3-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)[C@H]1NC(=O)C=C1O |
| InChI | InChI=1S/C7H11NO2/c1-4(2)7-5(9)3-6(10)8-7/h3-4,7,9H,1-2H3,(H,8,10)/t7-/m1/s1 |
| InChIKey | PZSSVTOYZDXYGI-SSDOTTSWSA-N |
| XLogP | 0.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |