C9H8LiNO2 — CID 10953937
lithium (4S)-4-phenyl-1,3-oxazolidin-3-id-2-one (PubChem CID 10953937) has the molecular formula C9H8LiNO2 and a molecular weight of 169.11 g/mol. Its IUPAC name is lithium (4S)-4-phenyl-1,3-oxazolidin-3-id-2-one.
| Compound Name | lithium (4S)-4-phenyl-1,3-oxazolidin-3-id-2-one |
|---|---|
| PubChem CID | 10953937 |
| Molecular Formula | C9H8LiNO2 |
| Molecular Weight | 169.11 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | lithium (4S)-4-phenyl-1,3-oxazolidin-3-id-2-one |
| SMILES | O=C1[N-][C@@H](c2ccccc2)CO1.[Li+] |
| InChI | InChI=1S/C9H9NO2.Li/c11-9-10-8(6-12-9)7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,10,11);/q;+1/p-1/t8-;/m1./s1 |
| InChIKey | HRFWPCNUKHEZCG-DDWIOCJRSA-M |
| XLogP | -0.74 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.11 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |