C22H17Cl2N3O5 — CID 1095405
N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 1095405) has the molecular formula C22H17Cl2N3O5 and a molecular weight of 474.30 g/mol. Its IUPAC name is N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 1095405 |
| Molecular Formula | C22H17Cl2N3O5 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(NC(=O)c3ccc(Cl)cc3Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17Cl2N3O5/c1-2-32-20-9-6-13(10-19(20)27(30)31)21(28)25-15-4-3-5-16(12-15)26-22(29)17-8-7-14(23)11-18(17)24/h3-12H,2H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | VMQVNFZDQZWDCU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|