C11H10N4 — CID 10954524
1-methyl-2-methylidenepentane-1,1,4,4-tetracarbonitrile (PubChem CID 10954524) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-methyl-2-methylidenepentane-1,1,4,4-tetracarbonitrile.
| Compound Name | 1-methyl-2-methylidenepentane-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 10954524 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-methyl-2-methylidenepentane-1,1,4,4-tetracarbonitrile |
| SMILES | C=C(CC(C)(C#N)C#N)C(C)(C#N)C#N |
| InChI | InChI=1S/C11H10N4/c1-9(11(3,7-14)8-15)4-10(2,5-12)6-13/h1,4H2,2-3H3 |
| InChIKey | LFECEHBPVFKIHR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|