C10H24O2Si — CID 10954691
(3S,4S)-2-methyl-3-(trimethylsilylmethyl)pentane-2,4-diol (PubChem CID 10954691) has the molecular formula C10H24O2Si and a molecular weight of 204.39 g/mol. Its IUPAC name is (3S,4S)-2-methyl-3-(trimethylsilylmethyl)pentane-2,4-diol.
| Compound Name | (3S,4S)-2-methyl-3-(trimethylsilylmethyl)pentane-2,4-diol |
|---|---|
| PubChem CID | 10954691 |
| Molecular Formula | C10H24O2Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (3S,4S)-2-methyl-3-(trimethylsilylmethyl)pentane-2,4-diol |
| SMILES | C[C@H](O)[C@H](C[Si](C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C10H24O2Si/c1-8(11)9(10(2,3)12)7-13(4,5)6/h8-9,11-12H,7H2,1-6H3/t8-,9-/m0/s1 |
| InChIKey | GLVODADIFDYJBX-IUCAKERBSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|