C8H9BrO3 — CID 10955448
3-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 10955448) has the molecular formula C8H9BrO3 and a molecular weight of 233.06 g/mol. Its IUPAC name is 3-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 3-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10955448 |
| Molecular Formula | C8H9BrO3 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC)C=CC(=O)C=C1Br |
| InChI | InChI=1S/C8H9BrO3/c1-11-8(12-2)4-3-6(10)5-7(8)9/h3-5H,1-2H3 |
| InChIKey | BMNNRIBGSKUTMH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|