C14H15F2NO3 — CID 10956981
(1,1-difluoro-3-oxo-3-phenylprop-1-en-2-yl) N,N-diethylcarbamate (PubChem CID 10956981) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is (1,1-difluoro-3-oxo-3-phenylprop-1-en-2-yl) N,N-diethylcarbamate.
| Compound Name | (1,1-difluoro-3-oxo-3-phenylprop-1-en-2-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 10956981 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1,1-difluoro-3-oxo-3-phenylprop-1-en-2-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(C(=O)c1ccccc1)=C(F)F |
| InChI | InChI=1S/C14H15F2NO3/c1-3-17(4-2)14(19)20-12(13(15)16)11(18)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | BYGJNHLTUQSUAH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|