C14H17F2NO3 — CID 138963596
[2-[4-(difluoromethyl)phenyl]-2-oxoethyl] N,N-diethylcarbamate (PubChem CID 138963596) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is [2-[4-(difluoromethyl)phenyl]-2-oxoethyl] N,N-diethylcarbamate.
| Compound Name | [2-[4-(difluoromethyl)phenyl]-2-oxoethyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 138963596 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [2-[4-(difluoromethyl)phenyl]-2-oxoethyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCC(=O)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C14H17F2NO3/c1-3-17(4-2)14(19)20-9-12(18)10-5-7-11(8-6-10)13(15)16/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | ZCAZFRCITJVCFK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |